C21H23N3O3 — CID 108975451
1-N-(3-acetamidophenyl)-1-N'-(1-phenylethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108975451) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-N-(3-acetamidophenyl)-1-N'-(1-phenylethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-acetamidophenyl)-1-N'-(1-phenylethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108975451 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-N-(3-acetamidophenyl)-1-N'-(1-phenylethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C2(C(=O)NC(C)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-14(16-7-4-3-5-8-16)22-19(26)21(11-12-21)20(27)24-18-10-6-9-17(13-18)23-15(2)25/h3-10,13-14H,11-12H2,1-2H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | QQZWVNDUOAEGDN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|