C13H16N2O2 — CID 68623726
1-N'-[(1S)-1-phenylethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 68623726) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-N'-[(1S)-1-phenylethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(1S)-1-phenylethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68623726 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-N'-[(1S)-1-phenylethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | C[C@H](NC(=O)C1(C(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c1-9(10-5-3-2-4-6-10)15-12(17)13(7-8-13)11(14)16/h2-6,9H,7-8H2,1H3,(H2,14,16)(H,15,17)/t9-/m0/s1 |
| InChIKey | GFEKKJQBNWCPOQ-VIFPVBQESA-N |
| XLogP | 1.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|