C18H21N3O3 — CID 108976615
1-N'-benzyl-1-N'-ethyl-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976615) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-N'-benzyl-1-N'-ethyl-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-benzyl-1-N'-ethyl-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976615 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-N'-benzyl-1-N'-ethyl-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1(C(=O)Nc2cc(C)on2)CC1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-21(12-14-7-5-4-6-8-14)17(23)18(9-10-18)16(22)19-15-11-13(2)24-20-15/h4-8,11H,3,9-10,12H2,1-2H3,(H,19,20,22) |
| InChIKey | CTZCOAWDYIQJFQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|