C16H14F3N3O3 — CID 108983363
1-N'-(5-methyl-1,2-oxazol-3-yl)-1-N-[2-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108983363) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-N'-(5-methyl-1,2-oxazol-3-yl)-1-N-[2-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(5-methyl-1,2-oxazol-3-yl)-1-N-[2-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108983363 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-N'-(5-methyl-1,2-oxazol-3-yl)-1-N-[2-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(NC(=O)C2(C(=O)Nc3ccccc3C(F)(F)F)CC2)no1 |
| InChI | InChI=1S/C16H14F3N3O3/c1-9-8-12(22-25-9)21-14(24)15(6-7-15)13(23)20-11-5-3-2-4-10(11)16(17,18)19/h2-5,8H,6-7H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | XSUFMNWGVFRMNY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|