C15H13F2N3O3 — CID 108983885
1-N'-(2,6-difluorophenyl)-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide (PubChem CID 108983885) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 1-N'-(2,6-difluorophenyl)-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2,6-difluorophenyl)-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108983885 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-N'-(2,6-difluorophenyl)-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(NC(=O)C2(C(=O)Nc3c(F)cccc3F)CC2)no1 |
| InChI | InChI=1S/C15H13F2N3O3/c1-8-7-11(20-23-8)18-13(21)15(5-6-15)14(22)19-12-9(16)3-2-4-10(12)17/h2-4,7H,5-6H2,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | HFDAIOVHBPSEGU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|