C13H16N2O3 — CID 112735210
2-amino-N-(1,3-benzodioxol-5-yl)-3-cyclopropylpropanamide (PubChem CID 112735210) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzodioxol-5-yl)-3-cyclopropylpropanamide.
| Compound Name | 2-amino-N-(1,3-benzodioxol-5-yl)-3-cyclopropylpropanamide |
|---|---|
| PubChem CID | 112735210 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-amino-N-(1,3-benzodioxol-5-yl)-3-cyclopropylpropanamide |
| SMILES | NC(CC1CC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16N2O3/c14-10(5-8-1-2-8)13(16)15-9-3-4-11-12(6-9)18-7-17-11/h3-4,6,8,10H,1-2,5,7,14H2,(H,15,16) |
| InChIKey | KEVCGTJPTPTNRT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |