C16H17BrFN3 — CID 111076957
2-[(3-bromo-5-fluorophenyl)methyl]-1-(4-ethylphenyl)guanidine (PubChem CID 111076957) has the molecular formula C16H17BrFN3 and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-1-(4-ethylphenyl)guanidine.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-(4-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 111076957 |
| Molecular Formula | C16H17BrFN3 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-(4-ethylphenyl)guanidine |
| SMILES | CCc1ccc(N/C(N)=N/Cc2cc(F)cc(Br)c2)cc1 |
| InChI | InChI=1S/C16H17BrFN3/c1-2-11-3-5-15(6-4-11)21-16(19)20-10-12-7-13(17)9-14(18)8-12/h3-9H,2,10H2,1H3,(H3,19,20,21) |
| InChIKey | HGWBVBSPHTUOLD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|