C14H10BrCl2NS2 — CID 3883798
(3,4-dichlorophenyl)methyl N-(4-bromophenyl)carbamodithioate (PubChem CID 3883798) has the molecular formula C14H10BrCl2NS2 and a molecular weight of 407.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl N-(4-bromophenyl)carbamodithioate.
| Compound Name | (3,4-dichlorophenyl)methyl N-(4-bromophenyl)carbamodithioate |
|---|---|
| PubChem CID | 3883798 |
| Molecular Formula | C14H10BrCl2NS2 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 404.88 |
| IUPAC Name | (3,4-dichlorophenyl)methyl N-(4-bromophenyl)carbamodithioate |
| SMILES | S=C(Nc1ccc(Br)cc1)SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrCl2NS2/c15-10-2-4-11(5-3-10)18-14(19)20-8-9-1-6-12(16)13(17)7-9/h1-7H,8H2,(H,18,19) |
| InChIKey | AOZXIXDHVSKSCI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|