C14H11F2NS2 — CID 4213909
(4-fluorophenyl)methyl N-(4-fluorophenyl)carbamodithioate (PubChem CID 4213909) has the molecular formula C14H11F2NS2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-(4-fluorophenyl)carbamodithioate.
| Compound Name | (4-fluorophenyl)methyl N-(4-fluorophenyl)carbamodithioate |
|---|---|
| PubChem CID | 4213909 |
| Molecular Formula | C14H11F2NS2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (4-fluorophenyl)methyl N-(4-fluorophenyl)carbamodithioate |
| SMILES | Fc1ccc(CSC(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H11F2NS2/c15-11-3-1-10(2-4-11)9-19-14(18)17-13-7-5-12(16)6-8-13/h1-8H,9H2,(H,17,18) |
| InChIKey | IDENYHKRFISLHI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|