C20H26FNOS2Si — CID 154606108
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-(4-fluorophenyl)carbamodithioate (PubChem CID 154606108) has the molecular formula C20H26FNOS2Si and a molecular weight of 407.65 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-(4-fluorophenyl)carbamodithioate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-(4-fluorophenyl)carbamodithioate |
|---|---|
| PubChem CID | 154606108 |
| Molecular Formula | C20H26FNOS2Si |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-(4-fluorophenyl)carbamodithioate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CSC(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H26FNOS2Si/c1-20(2,3)26(4,5)23-18-12-6-15(7-13-18)14-25-19(24)22-17-10-8-16(21)9-11-17/h6-13H,14H2,1-5H3,(H,22,24) |
| InChIKey | SVTSCCIIJGHFAJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|