C23H30FNO3Si — CID 138965368
methyl 2-[(R)-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-(4-fluoroanilino)methyl]prop-2-enoate (PubChem CID 138965368) has the molecular formula C23H30FNO3Si and a molecular weight of 415.58 g/mol. Its IUPAC name is methyl 2-[(R)-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-(4-fluoroanilino)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(R)-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-(4-fluoroanilino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 138965368 |
| Molecular Formula | C23H30FNO3Si |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | methyl 2-[(R)-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-(4-fluoroanilino)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H](Nc1ccc(F)cc1)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30FNO3Si/c1-16(22(26)27-5)21(25-19-12-10-18(24)11-13-19)17-8-14-20(15-9-17)28-29(6,7)23(2,3)4/h8-15,21,25H,1H2,2-7H3/t21-/m0/s1 |
| InChIKey | RHNLBQOZMMPPCJ-NRFANRHFSA-N |
| XLogP | 6.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|