C15H24O4Si — CID 167742574
2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methoxyacetic acid (PubChem CID 167742574) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methoxyacetic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 167742574 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methoxyacetic acid |
| SMILES | COC(C(=O)O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O4Si/c1-15(2,3)20(5,6)19-12-9-7-11(8-10-12)13(18-4)14(16)17/h7-10,13H,1-6H3,(H,16,17) |
| InChIKey | UFXIXTZCYPYUCB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|