C17H28O5Si — CID 18443665
3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]-2-methoxypropanoic acid (PubChem CID 18443665) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]-2-methoxypropanoic acid.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 18443665 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]-2-methoxypropanoic acid |
| SMILES | COc1cc(O[Si](C)(C)C(C)(C)C)ccc1CC(OC)C(=O)O |
| InChI | InChI=1S/C17H28O5Si/c1-17(2,3)23(6,7)22-13-9-8-12(14(11-13)20-4)10-15(21-5)16(18)19/h8-9,11,15H,10H2,1-7H3,(H,18,19) |
| InChIKey | ZFVCMXZUYBEMSQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|