C19H30ClNO3Si — CID 10762555
N-[3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]propyl]-2-oxopropanimidoyl chloride (PubChem CID 10762555) has the molecular formula C19H30ClNO3Si and a molecular weight of 383.99 g/mol. Its IUPAC name is N-[3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]propyl]-2-oxopropanimidoyl chloride.
| Compound Name | N-[3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]propyl]-2-oxopropanimidoyl chloride |
|---|---|
| PubChem CID | 10762555 |
| Molecular Formula | C19H30ClNO3Si |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[3-[4-[tert-butyl(dimethyl)silyl]oxy-2-methoxyphenyl]propyl]-2-oxopropanimidoyl chloride |
| SMILES | COc1cc(O[Si](C)(C)C(C)(C)C)ccc1CCC/N=C(\Cl)C(C)=O |
| InChI | InChI=1S/C19H30ClNO3Si/c1-14(22)18(20)21-12-8-9-15-10-11-16(13-17(15)23-5)24-25(6,7)19(2,3)4/h10-11,13H,8-9,12H2,1-7H3/b21-18- |
| InChIKey | HPRPTAZBKNKQAE-UZYVYHOESA-N |
| XLogP | 5.24 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|