C11H17BrIN3O — CID 110029294
2-[3-(4-bromo-2-methoxyphenyl)propyl]guanidine;hydroiodide (PubChem CID 110029294) has the molecular formula C11H17BrIN3O and a molecular weight of 414.09 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-methoxyphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(4-bromo-2-methoxyphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110029294 |
| Molecular Formula | C11H17BrIN3O |
| Molecular Weight | 414.09 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 2-[3-(4-bromo-2-methoxyphenyl)propyl]guanidine;hydroiodide |
| SMILES | COc1cc(Br)ccc1CCCN=C(N)N.I |
| InChI | InChI=1S/C11H16BrN3O.HI/c1-16-10-7-9(12)5-4-8(10)3-2-6-15-11(13)14;/h4-5,7H,2-3,6H2,1H3,(H4,13,14,15);1H |
| InChIKey | GHOYMELHIFOPDO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|