C14H21BrFN3 — CID 111814596
2-[3-(4-bromo-2-fluorophenyl)propyl]-1,1-diethylguanidine (PubChem CID 111814596) has the molecular formula C14H21BrFN3 and a molecular weight of 330.25 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,1-diethylguanidine.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111814596 |
| Molecular Formula | C14H21BrFN3 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCCc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H21BrFN3/c1-3-19(4-2)14(17)18-9-5-6-11-7-8-12(15)10-13(11)16/h7-8,10H,3-6,9H2,1-2H3,(H2,17,18) |
| InChIKey | WMZZLGZQJMRIGW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|