C10H14BrNO — CID 117219351
1-(4-bromo-2-methoxyphenyl)-N,N-dimethylmethanamine (PubChem CID 117219351) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 117219351 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-N,N-dimethylmethanamine |
| SMILES | COc1cc(Br)ccc1CN(C)C |
| InChI | InChI=1S/C10H14BrNO/c1-12(2)7-8-4-5-9(11)6-10(8)13-3/h4-6H,7H2,1-3H3 |
| InChIKey | GIUIUGZXJVKJEK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |