C14H21ClO3Si — CID 70132721
2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetic acid (PubChem CID 70132721) has the molecular formula C14H21ClO3Si and a molecular weight of 300.86 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetic acid |
|---|---|
| PubChem CID | 70132721 |
| Molecular Formula | C14H21ClO3Si |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClO3Si/c1-14(2,3)19(4,5)18-12(13(16)17)10-6-8-11(15)9-7-10/h6-9,12H,1-5H3,(H,16,17) |
| InChIKey | BJOXZLLINMPXLP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|