C19H29ClO3Si — CID 10926723
methyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hex-4-enoate (PubChem CID 10926723) has the molecular formula C19H29ClO3Si and a molecular weight of 368.98 g/mol. Its IUPAC name is methyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hex-4-enoate.
| Compound Name | methyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hex-4-enoate |
|---|---|
| PubChem CID | 10926723 |
| Molecular Formula | C19H29ClO3Si |
| Molecular Weight | 368.98 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (E,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-chlorophenyl)hex-4-enoate |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H29ClO3Si/c1-8-9-16(23-24(6,7)19(2,3)4)17(18(21)22-5)14-10-12-15(20)13-11-14/h8-13,16-17H,1-7H3/b9-8+/t16-,17+/m1/s1 |
| InChIKey | RGYSWUOHWPJSBF-LJFOUZCWSA-N |
| XLogP | 5.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.98 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|