C17H29NO4Si — CID 122377254
methyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propanoate (PubChem CID 122377254) has the molecular formula C17H29NO4Si and a molecular weight of 339.51 g/mol. Its IUPAC name is methyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 122377254 |
| Molecular Formula | C17H29NO4Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | methyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H29NO4Si/c1-17(2,3)23(6,7)22-15(14(18)16(19)21-5)12-8-10-13(20-4)11-9-12/h8-11,14-15H,18H2,1-7H3/t14-,15-/m0/s1 |
| InChIKey | FUXHOVXEJJICDP-GJZGRUSLSA-N |
| XLogP | 3.26 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|