C19H32O6Si — CID 102513329
methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-3-(4-methoxyphenyl)propanoate (PubChem CID 102513329) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 102513329 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)C(OC)C(OC)(O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H32O6Si/c1-18(2,3)26(8,9)25-19(24-7,16(22-5)17(20)23-6)14-10-12-15(21-4)13-11-14/h10-13,16H,1-9H3 |
| InChIKey | QUCFPOZBUKFAEW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|