C26H38O4Si — CID 101444869
(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-one (PubChem CID 101444869) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-one.
| Compound Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 101444869 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(4-methoxyphenyl)-2,3-dimethylbutan-1-one |
| SMILES | COc1ccc(C(=O)[C@@H](C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H38O4Si/c1-18(24(27)20-10-14-22(28-6)15-11-20)19(2)25(30-31(8,9)26(3,4)5)21-12-16-23(29-7)17-13-21/h10-19,25H,1-9H3/t18-,19-,25-/m0/s1 |
| InChIKey | NQMUMBUSQLDTIF-MHPIHPPYSA-N |
| XLogP | 6.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|