C19H36NO5PSi — CID 10993448
(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine (PubChem CID 10993448) has the molecular formula C19H36NO5PSi and a molecular weight of 417.56 g/mol. Its IUPAC name is (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine.
| Compound Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 10993448 |
| Molecular Formula | C19H36NO5PSi |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H36NO5PSi/c1-9-23-26(21,24-10-2)18(20)17(25-27(7,8)19(3,4)5)15-11-13-16(22-6)14-12-15/h11-14,17-18H,9-10,20H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | MVVACYSDNLAJCX-ZWKOTPCHSA-N |
| XLogP | 5.31 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|