C13H20F2NO4P — CID 177387905
(1R)-2-diethoxyphosphoryl-2,2-difluoro-1-(4-methoxyphenyl)ethanamine (PubChem CID 177387905) has the molecular formula C13H20F2NO4P and a molecular weight of 323.28 g/mol. Its IUPAC name is (1R)-2-diethoxyphosphoryl-2,2-difluoro-1-(4-methoxyphenyl)ethanamine.
| Compound Name | (1R)-2-diethoxyphosphoryl-2,2-difluoro-1-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 177387905 |
| Molecular Formula | C13H20F2NO4P |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (1R)-2-diethoxyphosphoryl-2,2-difluoro-1-(4-methoxyphenyl)ethanamine |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H](N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H20F2NO4P/c1-4-19-21(17,20-5-2)13(14,15)12(16)10-6-8-11(18-3)9-7-10/h6-9,12H,4-5,16H2,1-3H3/t12-/m1/s1 |
| InChIKey | LYCZXHRKQZGCTP-GFCCVEGCSA-N |
| XLogP | 3.55 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|