C12H16BrF2O4P — CID 163325177
1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol (PubChem CID 163325177) has the molecular formula C12H16BrF2O4P and a molecular weight of 373.13 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol.
| Compound Name | 1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol |
|---|---|
| PubChem CID | 163325177 |
| Molecular Formula | C12H16BrF2O4P |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H16BrF2O4P/c1-3-18-20(17,19-4-2)12(14,15)11(16)9-5-7-10(13)8-6-9/h5-8,11,16H,3-4H2,1-2H3 |
| InChIKey | KXQPKEYQTSDNRZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|