C13H23F2O8P — CID 10667227
diethyl 2-(2-diethoxyphosphoryl-2,2-difluoro-1-hydroxyethyl)propanedioate (PubChem CID 10667227) has the molecular formula C13H23F2O8P and a molecular weight of 376.29 g/mol. Its IUPAC name is diethyl 2-(2-diethoxyphosphoryl-2,2-difluoro-1-hydroxyethyl)propanedioate.
| Compound Name | diethyl 2-(2-diethoxyphosphoryl-2,2-difluoro-1-hydroxyethyl)propanedioate |
|---|---|
| PubChem CID | 10667227 |
| Molecular Formula | C13H23F2O8P |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | diethyl 2-(2-diethoxyphosphoryl-2,2-difluoro-1-hydroxyethyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(O)C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H23F2O8P/c1-5-20-11(17)9(12(18)21-6-2)10(16)13(14,15)24(19,22-7-3)23-8-4/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | UAHFNNHDNYDEFG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|