C9H17F3NO4P — CID 132510058
(4S)-4-amino-4-diethoxyphosphoryl-5,5,5-trifluoropentan-2-one (PubChem CID 132510058) has the molecular formula C9H17F3NO4P and a molecular weight of 291.21 g/mol. Its IUPAC name is (4S)-4-amino-4-diethoxyphosphoryl-5,5,5-trifluoropentan-2-one.
| Compound Name | (4S)-4-amino-4-diethoxyphosphoryl-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 132510058 |
| Molecular Formula | C9H17F3NO4P |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (4S)-4-amino-4-diethoxyphosphoryl-5,5,5-trifluoropentan-2-one |
| SMILES | CCOP(=O)(OCC)[C@@](N)(CC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3NO4P/c1-4-16-18(15,17-5-2)8(13,6-7(3)14)9(10,11)12/h4-6,13H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZDXFLCFPJPJOMF-QMMMGPOBSA-N |
| XLogP | 2.45 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|