C14H24F6NO5P — CID 2781214
ethyl N-(2-dibutoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 2781214) has the molecular formula C14H24F6NO5P and a molecular weight of 431.31 g/mol. Its IUPAC name is ethyl N-(2-dibutoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | ethyl N-(2-dibutoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 2781214 |
| Molecular Formula | C14H24F6NO5P |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | ethyl N-(2-dibutoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | CCCCOP(=O)(OCCCC)C(NC(=O)OCC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H24F6NO5P/c1-4-7-9-25-27(23,26-10-8-5-2)12(13(15,16)17,14(18,19)20)21-11(22)24-6-3/h4-10H2,1-3H3,(H,21,22) |
| InChIKey | VBZGXFZYJSLYMP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|