C10H18F3O5P — CID 11864759
ethyl (2S)-2-[butoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate (PubChem CID 11864759) has the molecular formula C10H18F3O5P and a molecular weight of 306.22 g/mol. Its IUPAC name is ethyl (2S)-2-[butoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-[butoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 11864759 |
| Molecular Formula | C10H18F3O5P |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | ethyl (2S)-2-[butoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate |
| SMILES | CCCCO[P@@](C)(=O)O[C@@H](C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C10H18F3O5P/c1-4-6-7-17-19(3,15)18-8(10(11,12)13)9(14)16-5-2/h8H,4-7H2,1-3H3/t8-,19+/m0/s1 |
| InChIKey | BBBFSMOJRZSRHP-WPCRTTGESA-N |
| XLogP | 3.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|