C11H20F3O6P — CID 610019
ethyl 2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate (PubChem CID 610019) has the molecular formula C11H20F3O6P and a molecular weight of 336.24 g/mol. Its IUPAC name is ethyl 2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 610019 |
| Molecular Formula | C11H20F3O6P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethyl 2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(OP(=O)(OC(C)C)OC(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F3O6P/c1-6-17-10(15)9(11(12,13)14)20-21(16,18-7(2)3)19-8(4)5/h7-9H,6H2,1-5H3 |
| InChIKey | WCEFHHYPRXXMQK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|