C10H18F3O5P — CID 11864406
ethyl (2S)-3,3,3-trifluoro-2-[methyl(2-methylpropoxy)phosphoryl]oxypropanoate (PubChem CID 11864406) has the molecular formula C10H18F3O5P and a molecular weight of 306.22 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-[methyl(2-methylpropoxy)phosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-[methyl(2-methylpropoxy)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 11864406 |
| Molecular Formula | C10H18F3O5P |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-[methyl(2-methylpropoxy)phosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](O[P@](C)(=O)OCC(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H18F3O5P/c1-5-16-9(14)8(10(11,12)13)18-19(4,15)17-6-7(2)3/h7-8H,5-6H2,1-4H3/t8-,19+/m0/s1 |
| InChIKey | BREMCRZJQVWKEK-WPCRTTGESA-N |
| XLogP | 2.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|