C7H12F3O6P — CID 7038863
ethyl (2R)-2-dimethoxyphosphoryloxy-3,3,3-trifluoropropanoate (PubChem CID 7038863) has the molecular formula C7H12F3O6P and a molecular weight of 280.13 g/mol. Its IUPAC name is ethyl (2R)-2-dimethoxyphosphoryloxy-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2R)-2-dimethoxyphosphoryloxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 7038863 |
| Molecular Formula | C7H12F3O6P |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl (2R)-2-dimethoxyphosphoryloxy-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@@H](OP(=O)(OC)OC)C(F)(F)F |
| InChI | InChI=1S/C7H12F3O6P/c1-4-15-6(11)5(7(8,9)10)16-17(12,13-2)14-3/h5H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | LHHMIKHXDBIEQK-RXMQYKEDSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|