C10H18F3O6P — CID 7021217
methyl (2S)-2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate (PubChem CID 7021217) has the molecular formula C10H18F3O6P and a molecular weight of 322.22 g/mol. Its IUPAC name is methyl (2S)-2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2S)-2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 7021217 |
| Molecular Formula | C10H18F3O6P |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | methyl (2S)-2-di(propan-2-yloxy)phosphoryloxy-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@H](OP(=O)(OC(C)C)OC(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H18F3O6P/c1-6(2)17-20(15,18-7(3)4)19-8(9(14)16-5)10(11,12)13/h6-8H,1-5H3/t8-/m0/s1 |
| InChIKey | ZDYIYMOKTDFBPT-QMMMGPOBSA-N |
| XLogP | 3.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|