C5H7F3O5S — CID 139604101
methyl 3,3,3-trifluoro-2-methylsulfonyloxypropanoate (PubChem CID 139604101) has the molecular formula C5H7F3O5S and a molecular weight of 236.17 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-methylsulfonyloxypropanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 139604101 |
| Molecular Formula | C5H7F3O5S |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-methylsulfonyloxypropanoate |
| SMILES | COC(=O)C(OS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C5H7F3O5S/c1-12-4(9)3(5(6,7)8)13-14(2,10)11/h3H,1-2H3 |
| InChIKey | HEPAMTLCJDTSBJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|