C8H10F6N2O8S2 — CID 102512577
dimethyl (2S,3R)-2,3-bis(trifluoromethylsulfonylamino)butanedioate (PubChem CID 102512577) has the molecular formula C8H10F6N2O8S2 and a molecular weight of 440.30 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3-bis(trifluoromethylsulfonylamino)butanedioate.
| Compound Name | dimethyl (2S,3R)-2,3-bis(trifluoromethylsulfonylamino)butanedioate |
|---|---|
| PubChem CID | 102512577 |
| Molecular Formula | C8H10F6N2O8S2 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | dimethyl (2S,3R)-2,3-bis(trifluoromethylsulfonylamino)butanedioate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)C(F)(F)F)[C@@H](NS(=O)(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C8H10F6N2O8S2/c1-23-5(17)3(15-25(19,20)7(9,10)11)4(6(18)24-2)16-26(21,22)8(12,13)14/h3-4,15-16H,1-2H3/t3-,4+ |
| InChIKey | DJMWWBABNDUYFU-ZXZARUISSA-N |
| XLogP | -1.05 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |