C10H22N2O4S — CID 114811428
methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate (PubChem CID 114811428) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate.
| Compound Name | methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 114811428 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate |
| SMILES | COC(=O)C(NS(=O)(=O)NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2O4S/c1-7(2)8(9(13)16-6)11-17(14,15)12-10(3,4)5/h7-8,11-12H,1-6H3 |
| InChIKey | KGTPTIHRDWFVIR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |