methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate

C10H22N2O4S — CID 114811428

IUPACmethyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate
SMILESCOC(=O)C(NS(=O)(=O)NC(C)(C)C)C(C)C
InChIInChI=1S/C10H22N2O4S/c1-7(2)8(9(13)16-6)11-17(14,15)12-10(3,4)5/h7-8,11-12H,1-6H3
InChIKeyKGTPTIHRDWFVIR-UHFFFAOYSA-N
MW266.36 g/mol
LogP0.41
Rot. Bonds5

About methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate

methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate (PubChem CID 114811428) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate
PubChem CID114811428
Molecular FormulaC10H22N2O4S
Molecular Weight266.36 g/mol
Exact Mass266.13
IUPAC Namemethyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate
SMILESCOC(=O)C(NS(=O)(=O)NC(C)(C)C)C(C)C
InChIInChI=1S/C10H22N2O4S/c1-7(2)8(9(13)16-6)11-17(14,15)12-10(3,4)5/h7-8,11-12H,1-6H3
InChIKeyKGTPTIHRDWFVIR-UHFFFAOYSA-N
XLogP0.41
TPSA84.50 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.36
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate?
The IUPAC name of methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate (CID 114811428) is methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate.
What is the SMILES notation for methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate?
The canonical SMILES for methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate is COC(=O)C(NS(=O)(=O)NC(C)(C)C)C(C)C.
What is the InChIKey of methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate?
The InChIKey is KGTPTIHRDWFVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O4S/c1-7(2)8(9(13)16-6)11-17(14,15)12-10(3,4)5/h7-8,11-12H,1-6H3.
What are the key properties of methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate?
methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate has a molecular weight of 266.36 g/mol, XLogP of 0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(tert-butylsulfamoylamino)-3-methylbutanoate is sourced from PubChem (CID 114811428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).