C7H14N2O6S — CID 10682346
dimethyl (2S,3R)-2-amino-3-(methanesulfonamido)butanedioate (PubChem CID 10682346) has the molecular formula C7H14N2O6S and a molecular weight of 254.26 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-amino-3-(methanesulfonamido)butanedioate.
| Compound Name | dimethyl (2S,3R)-2-amino-3-(methanesulfonamido)butanedioate |
|---|---|
| PubChem CID | 10682346 |
| Molecular Formula | C7H14N2O6S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | dimethyl (2S,3R)-2-amino-3-(methanesulfonamido)butanedioate |
| SMILES | COC(=O)[C@@H](N)[C@@H](NS(C)(=O)=O)C(=O)OC |
| InChI | InChI=1S/C7H14N2O6S/c1-14-6(10)4(8)5(7(11)15-2)9-16(3,12)13/h4-5,9H,8H2,1-3H3/t4-,5+/m0/s1 |
| InChIKey | LVGXPNSFTMVBNV-CRCLSJGQSA-N |
| XLogP | -2.42 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |