C10H21NO4S — CID 64585319
methyl 3-methyl-2-(propan-2-ylsulfonylamino)pentanoate (PubChem CID 64585319) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is methyl 3-methyl-2-(propan-2-ylsulfonylamino)pentanoate.
| Compound Name | methyl 3-methyl-2-(propan-2-ylsulfonylamino)pentanoate |
|---|---|
| PubChem CID | 64585319 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl 3-methyl-2-(propan-2-ylsulfonylamino)pentanoate |
| SMILES | CCC(C)C(NS(=O)(=O)C(C)C)C(=O)OC |
| InChI | InChI=1S/C10H21NO4S/c1-6-8(4)9(10(12)15-5)11-16(13,14)7(2)3/h7-9,11H,6H2,1-5H3 |
| InChIKey | QLYKOJFIEIEAJM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |