C10H19NO6S — CID 43716066
3-[(1-methoxy-3-methyl-1-oxopentan-2-yl)sulfamoyl]propanoic acid (PubChem CID 43716066) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-[(1-methoxy-3-methyl-1-oxopentan-2-yl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(1-methoxy-3-methyl-1-oxopentan-2-yl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43716066 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[(1-methoxy-3-methyl-1-oxopentan-2-yl)sulfamoyl]propanoic acid |
| SMILES | CCC(C)C(NS(=O)(=O)CCC(=O)O)C(=O)OC |
| InChI | InChI=1S/C10H19NO6S/c1-4-7(2)9(10(14)17-3)11-18(15,16)6-5-8(12)13/h7,9,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | JURTZTLWPCFIRS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |