C8H15NO6S — CID 78972767
(2R)-2-[(3-ethoxy-3-oxopropyl)sulfonylamino]propanoic acid (PubChem CID 78972767) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is (2R)-2-[(3-ethoxy-3-oxopropyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(3-ethoxy-3-oxopropyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 78972767 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (2R)-2-[(3-ethoxy-3-oxopropyl)sulfonylamino]propanoic acid |
| SMILES | CCOC(=O)CCS(=O)(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C8H15NO6S/c1-3-15-7(10)4-5-16(13,14)9-6(2)8(11)12/h6,9H,3-5H2,1-2H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | GYAZPMZSXQBKQG-ZCFIWIBFSA-N |
| XLogP | -0.67 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |