C10H19NO6S — CID 81065562
4-[(3-ethoxy-3-oxopropyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 81065562) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81065562 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CCOC(=O)CCS(=O)(=O)NCC(C)CC(=O)O |
| InChI | InChI=1S/C10H19NO6S/c1-3-17-10(14)4-5-18(15,16)11-7-8(2)6-9(12)13/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | RTDQXWMEYNYVQL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |