C8H17NO4S2 — CID 63964847
3-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid (PubChem CID 63964847) has the molecular formula C8H17NO4S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 63964847 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid |
| SMILES | CSCC(C)CNS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C8H17NO4S2/c1-7(6-14-2)5-9-15(12,13)4-3-8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | UJVBBERWJLLKLQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |