C9H19NO5S — CID 82684266
5-(2-methoxyethylsulfonylamino)-4-methylpentanoic acid (PubChem CID 82684266) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfonylamino)-4-methylpentanoic acid.
| Compound Name | 5-(2-methoxyethylsulfonylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82684266 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-(2-methoxyethylsulfonylamino)-4-methylpentanoic acid |
| SMILES | COCCS(=O)(=O)NCC(C)CCC(=O)O |
| InChI | InChI=1S/C9H19NO5S/c1-8(3-4-9(11)12)7-10-16(13,14)6-5-15-2/h8,10H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | BFDCCGPSXLMZJY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |