C7H15NO6S — CID 104936769
2-methoxy-3-(2-methoxyethylsulfonylamino)propanoic acid (PubChem CID 104936769) has the molecular formula C7H15NO6S and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-methoxy-3-(2-methoxyethylsulfonylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(2-methoxyethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 104936769 |
| Molecular Formula | C7H15NO6S |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-methoxy-3-(2-methoxyethylsulfonylamino)propanoic acid |
| SMILES | COCCS(=O)(=O)NCC(OC)C(=O)O |
| InChI | InChI=1S/C7H15NO6S/c1-13-3-4-15(11,12)8-5-6(14-2)7(9)10/h6,8H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | LUBROGILRDQCMN-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |