C8H17NO6S — CID 104936720
2-methoxy-3-(3-methoxypropylsulfonylamino)propanoic acid (PubChem CID 104936720) has the molecular formula C8H17NO6S and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-methoxy-3-(3-methoxypropylsulfonylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(3-methoxypropylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 104936720 |
| Molecular Formula | C8H17NO6S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-methoxy-3-(3-methoxypropylsulfonylamino)propanoic acid |
| SMILES | COCCCS(=O)(=O)NCC(OC)C(=O)O |
| InChI | InChI=1S/C8H17NO6S/c1-14-4-3-5-16(12,13)9-6-7(15-2)8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | DTYKHRTVSCGXSM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|