C7H15F2NO4S — CID 103731723
N-(3,3-difluoro-2-hydroxypropyl)-3-methoxypropane-1-sulfonamide (PubChem CID 103731723) has the molecular formula C7H15F2NO4S and a molecular weight of 247.26 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 103731723 |
| Molecular Formula | C7H15F2NO4S |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C7H15F2NO4S/c1-14-3-2-4-15(12,13)10-5-6(11)7(8)9/h6-7,10-11H,2-5H2,1H3 |
| InChIKey | VFYZZYVDJKIGSA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|