C9H22N2O3S — CID 115365924
N-(3-amino-2,2-dimethylpropyl)-3-methoxypropane-1-sulfonamide (PubChem CID 115365924) has the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 115365924 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NCC(C)(C)CN |
| InChI | InChI=1S/C9H22N2O3S/c1-9(2,7-10)8-11-15(12,13)6-4-5-14-3/h11H,4-8,10H2,1-3H3 |
| InChIKey | DYTRIAQAOGVNKW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|