C11H25NO4S — CID 113249315
N-(2-hydroxy-4,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide (PubChem CID 113249315) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 113249315 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C11H25NO4S/c1-11(2,3)8-10(13)9-12-17(14,15)7-5-6-16-4/h10,12-13H,5-9H2,1-4H3 |
| InChIKey | YFOJKRNOSPEEKN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|