C11H23NO5S — CID 107151263
4-[(2-hydroxy-4,4-dimethylpentyl)sulfamoyl]butanoic acid (PubChem CID 107151263) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is 4-[(2-hydroxy-4,4-dimethylpentyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(2-hydroxy-4,4-dimethylpentyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 107151263 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[(2-hydroxy-4,4-dimethylpentyl)sulfamoyl]butanoic acid |
| SMILES | CC(C)(C)CC(O)CNS(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H23NO5S/c1-11(2,3)7-9(13)8-12-18(16,17)6-4-5-10(14)15/h9,12-13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | JPWOLNXSFZTHBB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |