C8H17NO5S2 — CID 106244687
3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid (PubChem CID 106244687) has the molecular formula C8H17NO5S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 106244687 |
| Molecular Formula | C8H17NO5S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoic acid |
| SMILES | CSCC(C)(O)CNS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C8H17NO5S2/c1-8(12,6-15-2)5-9-16(13,14)4-3-7(10)11/h9,12H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | LBRVVPGWQVUQCE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |